C13H18F2N2O3 — CID 105123424
(4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanol (PubChem CID 105123424) has the molecular formula C13H18F2N2O3 and a molecular weight of 288.29 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanol.
| Compound Name | (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 105123424 |
| Molecular Formula | C13H18F2N2O3 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanol |
| SMILES | COc1cnc(C(O)C2CCC(F)(F)CC2)c(OC)n1 |
| InChI | InChI=1S/C13H18F2N2O3/c1-19-9-7-16-10(12(17-9)20-2)11(18)8-3-5-13(14,15)6-4-8/h7-8,11,18H,3-6H2,1-2H3 |
| InChIKey | KZIUQBTTZZUCOY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |