C13H17NO — CID 10512359
(3R,7aS)-7a-methyl-3-phenyl-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazole (PubChem CID 10512359) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (3R,7aS)-7a-methyl-3-phenyl-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazole.
| Compound Name | (3R,7aS)-7a-methyl-3-phenyl-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 10512359 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (3R,7aS)-7a-methyl-3-phenyl-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazole |
| SMILES | C[C@]12CCCN1[C@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C13H17NO/c1-13-8-5-9-14(13)12(10-15-13)11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | VBSGABCGIYBACB-STQMWFEESA-N |
| XLogP | 2.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |