C17H18BrNO2 — CID 105123843
1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-4-pyridin-2-ylbutan-2-ol (PubChem CID 105123843) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-4-pyridin-2-ylbutan-2-ol.
| Compound Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-4-pyridin-2-ylbutan-2-ol |
|---|---|
| PubChem CID | 105123843 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-4-pyridin-2-ylbutan-2-ol |
| SMILES | OC(CCc1ccccn1)Cc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C17H18BrNO2/c18-14-9-12-6-8-21-17(12)13(10-14)11-16(20)5-4-15-3-1-2-7-19-15/h1-3,7,9-10,16,20H,4-6,8,11H2 |
| InChIKey | VBADLVYOLPZUKU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |