C15H19F2NO2 — CID 105124282
(4,4-difluorocyclohexyl)-(5-propoxy-3-pyridinyl)methanone (PubChem CID 105124282) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(5-propoxy-3-pyridinyl)methanone.
| Compound Name | (4,4-difluorocyclohexyl)-(5-propoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 105124282 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(5-propoxy-3-pyridinyl)methanone |
| SMILES | CCCOc1cncc(C(=O)C2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C15H19F2NO2/c1-2-7-20-13-8-12(9-18-10-13)14(19)11-3-5-15(16,17)6-4-11/h8-11H,2-7H2,1H3 |
| InChIKey | JAXFNNIXOAHJSK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |