About spiro[adamantane-2,4'-oxane]
spiro[adamantane-2,4'-oxane] (PubChem CID 10512483) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is spiro[adamantane-2,4'-oxane].
Molecular Properties
| Compound Name | spiro[adamantane-2,4'-oxane] |
| PubChem CID | 10512483 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | spiro[adamantane-2,4'-oxane] |
| SMILES | C1CC2(CCO1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C14H22O/c1-3-15-4-2-14(1)12-6-10-5-11(8-12)9-13(14)7-10/h10-13H,1-9H2 |
| InChIKey | XSCDYXHFXFQNGS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[adamantane-2,4'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[adamantane-2,4'-oxane]?
The IUPAC name of spiro[adamantane-2,4'-oxane] (CID 10512483) is spiro[adamantane-2,4'-oxane].
What is the SMILES notation for spiro[adamantane-2,4'-oxane]?
The canonical SMILES for spiro[adamantane-2,4'-oxane] is C1CC2(CCO1)C1CC3CC(C1)CC2C3.
What is the InChIKey of spiro[adamantane-2,4'-oxane]?
The InChIKey is XSCDYXHFXFQNGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-3-15-4-2-14(1)12-6-10-5-11(8-12)9-13(14)7-10/h10-13H,1-9H2.
What are the key properties of spiro[adamantane-2,4'-oxane]?
spiro[adamantane-2,4'-oxane] has a molecular weight of 206.33 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[adamantane-2,4'-oxane] is sourced from PubChem (CID 10512483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).