About 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone
2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone (PubChem CID 105125924) has the molecular formula C8H6N2O2S
and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone |
| PubChem CID | 105125924 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone |
| SMILES | O=C(Cc1ccoc1)c1cnsn1 |
| InChI | InChI=1S/C8H6N2O2S/c11-8(7-4-9-13-10-7)3-6-1-2-12-5-6/h1-2,4-5H,3H2 |
| InChIKey | HDZWFXLRFUSZGS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone?
The IUPAC name of 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone (CID 105125924) is 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone.
What is the SMILES notation for 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone?
The canonical SMILES for 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone is O=C(Cc1ccoc1)c1cnsn1.
What is the InChIKey of 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone?
The InChIKey is HDZWFXLRFUSZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c11-8(7-4-9-13-10-7)3-6-1-2-12-5-6/h1-2,4-5H,3H2.
What are the key properties of 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone?
2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone has a molecular weight of 194.22 g/mol, XLogP of 1.56, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-3-yl)-1-(1,2,5-thiadiazol-3-yl)ethanone is sourced from PubChem (CID 105125924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).