C12H19NO2 — CID 10512609
(1R,4E,8S)-4-methoxyiminotricyclo[4.3.1.13,8]undecan-3-ol (PubChem CID 10512609) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (1R,4E,8S)-4-methoxyiminotricyclo[4.3.1.13,8]undecan-3-ol.
| Compound Name | (1R,4E,8S)-4-methoxyiminotricyclo[4.3.1.13,8]undecan-3-ol |
|---|---|
| PubChem CID | 10512609 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (1R,4E,8S)-4-methoxyiminotricyclo[4.3.1.13,8]undecan-3-ol |
| SMILES | CO/N=C1\CC2C[C@@H]3C[C@H](C2)CC1(O)C3 |
| InChI | InChI=1S/C12H19NO2/c1-15-13-11-5-8-2-9-4-10(3-8)7-12(11,14)6-9/h8-10,14H,2-7H2,1H3/b13-11+/t8?,9-,10+,12? |
| InChIKey | HBTVGNQBRULYFY-CNKJVMJKSA-N |
| XLogP | 1.95 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|