About trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate
trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate (PubChem CID 10512735) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate |
| PubChem CID | 10512735 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1CC[C@@H](C)[C@](O)(C(=O)OC(C)C)C1 |
| InChI | InChI=1S/C12H20O3/c1-8(2)15-11(13)12(14)7-9(3)5-6-10(12)4/h8,10,14H,3,5-7H2,1-2,4H3/t10-,12+/m1/s1 |
| InChIKey | ATXAXSGYNIHTPH-PWSUYJOCSA-N |
| XLogP | 2.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate?
The IUPAC name of trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate (CID 10512735) is trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate.
What is the SMILES notation for trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate?
The canonical SMILES for trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate is C=C1CC[C@@H](C)[C@](O)(C(=O)OC(C)C)C1.
What is the InChIKey of trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate?
The InChIKey is ATXAXSGYNIHTPH-PWSUYJOCSA-N. The full InChI is InChI=1S/C12H20O3/c1-8(2)15-11(13)12(14)7-9(3)5-6-10(12)4/h8,10,14H,3,5-7H2,1-2,4H3/t10-,12+/m1/s1.
What are the key properties of trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate?
trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate has a molecular weight of 212.29 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-propan-2-yl (1S,2R)-1-hydroxy-2-methyl-5-methylidenecyclohexane-1-carboxylate is sourced from PubChem (CID 10512735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).