C13H10O3 — CID 10512793
(1R,11S)-6-oxatetracyclo[9.2.1.02,10.04,8]tetradeca-2(10),4(8),12-triene-5,7-dione (PubChem CID 10512793) has the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is (1R,11S)-6-oxatetracyclo[9.2.1.02,10.04,8]tetradeca-2(10),4(8),12-triene-5,7-dione.
| Compound Name | (1R,11S)-6-oxatetracyclo[9.2.1.02,10.04,8]tetradeca-2(10),4(8),12-triene-5,7-dione |
|---|---|
| PubChem CID | 10512793 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (1R,11S)-6-oxatetracyclo[9.2.1.02,10.04,8]tetradeca-2(10),4(8),12-triene-5,7-dione |
| SMILES | O=C1OC(=O)C2=C1CC1=C(C2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C13H10O3/c14-12-10-4-8-6-1-2-7(3-6)9(8)5-11(10)13(15)16-12/h1-2,6-7H,3-5H2/t6-,7+ |
| InChIKey | FSLDUYSYAIDMBA-KNVOCYPGSA-N |
| XLogP | 1.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|