About methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate
methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate (PubChem CID 10512806) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate.
Molecular Properties
| Compound Name | methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate |
| PubChem CID | 10512806 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate |
| SMILES | C=C[C@](C)(O)CC/C=C(\CO)C(=O)OC |
| InChI | InChI=1S/C11H18O4/c1-4-11(2,14)7-5-6-9(8-12)10(13)15-3/h4,6,12,14H,1,5,7-8H2,2-3H3/b9-6+/t11-/m0/s1 |
| InChIKey | ZMYLTLIECAVXTL-LAHYYIKRSA-N |
| XLogP | 0.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate?
The IUPAC name of methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate (CID 10512806) is methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate.
What is the SMILES notation for methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate?
The canonical SMILES for methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate is C=C[C@](C)(O)CC/C=C(\CO)C(=O)OC.
What is the InChIKey of methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate?
The InChIKey is ZMYLTLIECAVXTL-LAHYYIKRSA-N. The full InChI is InChI=1S/C11H18O4/c1-4-11(2,14)7-5-6-9(8-12)10(13)15-3/h4,6,12,14H,1,5,7-8H2,2-3H3/b9-6+/t11-/m0/s1.
What are the key properties of methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate?
methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate has a molecular weight of 214.26 g/mol, XLogP of 0.80, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E,6R)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoate is sourced from PubChem (CID 10512806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).