About 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine
3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine (PubChem CID 10512835) has the molecular formula C11H26N4
and a molecular weight of 214.36 g/mol. Its IUPAC name is 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine |
| PubChem CID | 10512835 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine |
| SMILES | NCCCN1CCCN(CCCN)CC1 |
| InChI | InChI=1S/C11H26N4/c12-4-1-6-14-8-3-9-15(11-10-14)7-2-5-13/h1-13H2 |
| InChIKey | XYUCARGKJNKODR-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine?
The IUPAC name of 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine (CID 10512835) is 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine.
What is the SMILES notation for 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine?
The canonical SMILES for 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine is NCCCN1CCCN(CCCN)CC1.
What is the InChIKey of 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine?
The InChIKey is XYUCARGKJNKODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N4/c12-4-1-6-14-8-3-9-15(11-10-14)7-2-5-13/h1-13H2.
What are the key properties of 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine?
3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine has a molecular weight of 214.36 g/mol, XLogP of -0.31, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-aminopropyl)-1,4-diazepan-1-yl]propan-1-amine is sourced from PubChem (CID 10512835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).