C16H17N3OS — CID 105128651
1-(3-phenyltriazol-4-yl)-4-thiophen-2-ylbutan-1-ol (PubChem CID 105128651) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-(3-phenyltriazol-4-yl)-4-thiophen-2-ylbutan-1-ol.
| Compound Name | 1-(3-phenyltriazol-4-yl)-4-thiophen-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 105128651 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-(3-phenyltriazol-4-yl)-4-thiophen-2-ylbutan-1-ol |
| SMILES | OC(CCCc1cccs1)c1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C16H17N3OS/c20-16(10-4-8-14-9-5-11-21-14)15-12-17-18-19(15)13-6-2-1-3-7-13/h1-3,5-7,9,11-12,16,20H,4,8,10H2 |
| InChIKey | WHIWHPUNXMPICZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |