C15H14N2O2 — CID 105128840
1-benzofuran-2-yl-(3,6-dimethylpyridazin-4-yl)methanol (PubChem CID 105128840) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(3,6-dimethylpyridazin-4-yl)methanol.
| Compound Name | 1-benzofuran-2-yl-(3,6-dimethylpyridazin-4-yl)methanol |
|---|---|
| PubChem CID | 105128840 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-benzofuran-2-yl-(3,6-dimethylpyridazin-4-yl)methanol |
| SMILES | Cc1cc(C(O)c2cc3ccccc3o2)c(C)nn1 |
| InChI | InChI=1S/C15H14N2O2/c1-9-7-12(10(2)17-16-9)15(18)14-8-11-5-3-4-6-13(11)19-14/h3-8,15,18H,1-2H3 |
| InChIKey | JBDFAPHBARWOLG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |