About (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one
(3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one (PubChem CID 10512896) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one.
Molecular Properties
| Compound Name | (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one |
| PubChem CID | 10512896 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one |
| SMILES | CO[C@@H](C[C@@H]1CC[C@@H](C)[C@@H](O)O1)C(C)=O |
| InChI | InChI=1S/C11H20O4/c1-7-4-5-9(15-11(7)13)6-10(14-3)8(2)12/h7,9-11,13H,4-6H2,1-3H3/t7-,9+,10+,11+/m1/s1 |
| InChIKey | NZNNFNBTDJXCBC-PXIYARARSA-N |
| XLogP | 1.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one?
The IUPAC name of (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one (CID 10512896) is (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one.
What is the SMILES notation for (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one?
The canonical SMILES for (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one is CO[C@@H](C[C@@H]1CC[C@@H](C)[C@@H](O)O1)C(C)=O.
What is the InChIKey of (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one?
The InChIKey is NZNNFNBTDJXCBC-PXIYARARSA-N. The full InChI is InChI=1S/C11H20O4/c1-7-4-5-9(15-11(7)13)6-10(14-3)8(2)12/h7,9-11,13H,4-6H2,1-3H3/t7-,9+,10+,11+/m1/s1.
What are the key properties of (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one?
(3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one has a molecular weight of 216.28 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-[(2S,5R,6S)-6-hydroxy-5-methyloxan-2-yl]-3-methoxybutan-2-one is sourced from PubChem (CID 10512896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).