About tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate
tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate (PubChem CID 10512905) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate |
| PubChem CID | 10512905 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](/C=N/O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O3/c1-7(2)8(6-11-14)12-9(13)15-10(3,4)5/h6-8,14H,1-5H3,(H,12,13)/b11-6+/t8-/m1/s1 |
| InChIKey | JFGJGQNSFXHKAB-JMUHATKESA-N |
| XLogP | 2.00 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate (CID 10512905) is tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate is CC(C)[C@@H](/C=N/O)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate?
The InChIKey is JFGJGQNSFXHKAB-JMUHATKESA-N. The full InChI is InChI=1S/C10H20N2O3/c1-7(2)8(6-11-14)12-9(13)15-10(3,4)5/h6-8,14H,1-5H3,(H,12,13)/b11-6+/t8-/m1/s1.
What are the key properties of tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate?
tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate has a molecular weight of 216.28 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1E,2S)-1-hydroxyimino-3-methylbutan-2-yl]carbamate is sourced from PubChem (CID 10512905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).