C9H15NO5 — CID 10512934
(2R,5S,6R,7R,8R,8aS)-2,6,7,8-tetrahydroxy-5-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 10512934) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is (2R,5S,6R,7R,8R,8aS)-2,6,7,8-tetrahydroxy-5-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (2R,5S,6R,7R,8R,8aS)-2,6,7,8-tetrahydroxy-5-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 10512934 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (2R,5S,6R,7R,8R,8aS)-2,6,7,8-tetrahydroxy-5-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H]2C[C@@H](O)C(=O)N12 |
| InChI | InChI=1S/C9H15NO5/c1-3-6(12)8(14)7(13)4-2-5(11)9(15)10(3)4/h3-8,11-14H,2H2,1H3/t3-,4-,5+,6+,7+,8+/m0/s1 |
| InChIKey | ZTOFEKMEJWZZEY-JKVYXWIHSA-N |
| XLogP | -2.57 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |