About 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one
1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one (PubChem CID 10513083) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one.
Molecular Properties
| Compound Name | 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one |
| PubChem CID | 10513083 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one |
| SMILES | CC(C)C1CN(c2ccccc2)NC(=O)N1 |
| InChI | InChI=1S/C12H17N3O/c1-9(2)11-8-15(14-12(16)13-11)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H2,13,14,16) |
| InChIKey | ZANGYPYBJDVPLH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one?
The IUPAC name of 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one (CID 10513083) is 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one.
What is the SMILES notation for 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one?
The canonical SMILES for 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one is CC(C)C1CN(c2ccccc2)NC(=O)N1.
What is the InChIKey of 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one?
The InChIKey is ZANGYPYBJDVPLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-9(2)11-8-15(14-12(16)13-11)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H2,13,14,16).
What are the key properties of 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one?
1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one has a molecular weight of 219.29 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-5-propan-2-yl-1,2,4-triazinan-3-one is sourced from PubChem (CID 10513083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).