C14H14Br2FNS — CID 105131858
2-(5-bromo-2-fluorophenyl)-1-(5-bromothiophen-3-yl)-N-ethylethanamine (PubChem CID 105131858) has the molecular formula C14H14Br2FNS and a molecular weight of 407.15 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-1-(5-bromothiophen-3-yl)-N-ethylethanamine.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-1-(5-bromothiophen-3-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 105131858 |
| Molecular Formula | C14H14Br2FNS |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-1-(5-bromothiophen-3-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cc(Br)ccc1F)c1csc(Br)c1 |
| InChI | InChI=1S/C14H14Br2FNS/c1-2-18-13(10-7-14(16)19-8-10)6-9-5-11(15)3-4-12(9)17/h3-5,7-8,13,18H,2,6H2,1H3 |
| InChIKey | SDMZKWASIOWYGQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |