C10H14N4O2 — CID 10513218
1-(6-methoxy-2-pyridinyl)-5-methyl-1,2,4-triazinan-3-one (PubChem CID 10513218) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-(6-methoxy-2-pyridinyl)-5-methyl-1,2,4-triazinan-3-one.
| Compound Name | 1-(6-methoxy-2-pyridinyl)-5-methyl-1,2,4-triazinan-3-one |
|---|---|
| PubChem CID | 10513218 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-(6-methoxy-2-pyridinyl)-5-methyl-1,2,4-triazinan-3-one |
| SMILES | COc1cccc(N2CC(C)NC(=O)N2)n1 |
| InChI | InChI=1S/C10H14N4O2/c1-7-6-14(13-10(15)11-7)8-4-3-5-9(12-8)16-2/h3-5,7H,6H2,1-2H3,(H2,11,13,15) |
| InChIKey | NKNBJFAZVZMEBJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |