C14H22O2 — CID 10513246
(4aR,8aS)-4a,8-dimethylspiro[1,2,4,5,6,8a-hexahydronaphthalene-3,2'-1,3-dioxolane] (PubChem CID 10513246) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (4aR,8aS)-4a,8-dimethylspiro[1,2,4,5,6,8a-hexahydronaphthalene-3,2'-1,3-dioxolane].
| Compound Name | (4aR,8aS)-4a,8-dimethylspiro[1,2,4,5,6,8a-hexahydronaphthalene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 10513246 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (4aR,8aS)-4a,8-dimethylspiro[1,2,4,5,6,8a-hexahydronaphthalene-3,2'-1,3-dioxolane] |
| SMILES | CC1=CCC[C@]2(C)CC3(CC[C@H]12)OCCO3 |
| InChI | InChI=1S/C14H22O2/c1-11-4-3-6-13(2)10-14(7-5-12(11)13)15-8-9-16-14/h4,12H,3,5-10H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | BKZGYWGRERXFBN-CHWSQXEVSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|