About 1-trimethylsilyldeca-1,3-diyn-5-ol
1-trimethylsilyldeca-1,3-diyn-5-ol (PubChem CID 10513261) has the molecular formula C13H22OSi
and a molecular weight of 222.40 g/mol. Its IUPAC name is 1-trimethylsilyldeca-1,3-diyn-5-ol.
Molecular Properties
| Compound Name | 1-trimethylsilyldeca-1,3-diyn-5-ol |
| PubChem CID | 10513261 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-trimethylsilyldeca-1,3-diyn-5-ol |
| SMILES | CCCCCC(O)C#CC#C[Si](C)(C)C |
| InChI | InChI=1S/C13H22OSi/c1-5-6-7-10-13(14)11-8-9-12-15(2,3)4/h13-14H,5-7,10H2,1-4H3 |
| InChIKey | YICBTWWMZKDJEZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-trimethylsilyldeca-1,3-diyn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-trimethylsilyldeca-1,3-diyn-5-ol?
The IUPAC name of 1-trimethylsilyldeca-1,3-diyn-5-ol (CID 10513261) is 1-trimethylsilyldeca-1,3-diyn-5-ol.
What is the SMILES notation for 1-trimethylsilyldeca-1,3-diyn-5-ol?
The canonical SMILES for 1-trimethylsilyldeca-1,3-diyn-5-ol is CCCCCC(O)C#CC#C[Si](C)(C)C.
What is the InChIKey of 1-trimethylsilyldeca-1,3-diyn-5-ol?
The InChIKey is YICBTWWMZKDJEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22OSi/c1-5-6-7-10-13(14)11-8-9-12-15(2,3)4/h13-14H,5-7,10H2,1-4H3.
What are the key properties of 1-trimethylsilyldeca-1,3-diyn-5-ol?
1-trimethylsilyldeca-1,3-diyn-5-ol has a molecular weight of 222.40 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-trimethylsilyldeca-1,3-diyn-5-ol is sourced from PubChem (CID 10513261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).