C11H15NO4 — CID 10513373
7-(2,5-dioxopyrrol-1-yl)heptanoic acid (PubChem CID 10513373) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 7-(2,5-dioxopyrrol-1-yl)heptanoic acid.
| Compound Name | 7-(2,5-dioxopyrrol-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 10513373 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 7-(2,5-dioxopyrrol-1-yl)heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H15NO4/c13-9-6-7-10(14)12(9)8-4-2-1-3-5-11(15)16/h6-7H,1-5,8H2,(H,15,16) |
| InChIKey | DHELHOUTNAEDJP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|