C11H14O5 — CID 10513404
(1S,4S,6R,7R,9S,10R,11R)-7-hydroxy-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one (PubChem CID 10513404) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is (1S,4S,6R,7R,9S,10R,11R)-7-hydroxy-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one.
| Compound Name | (1S,4S,6R,7R,9S,10R,11R)-7-hydroxy-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one |
|---|---|
| PubChem CID | 10513404 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (1S,4S,6R,7R,9S,10R,11R)-7-hydroxy-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one |
| SMILES | C[C@]12O[C@@H](O)[C@@H]3C[C@@H]4C(=O)O[C@](C)(O1)[C@@H]4[C@@H]32 |
| InChI | InChI=1S/C11H14O5/c1-10-6-4(8(12)14-10)3-5-7(6)11(2,16-10)15-9(5)13/h4-8,12H,3H2,1-2H3/t4-,5+,6-,7+,8-,10+,11-/m1/s1 |
| InChIKey | QXQKDNOZMJWKAV-KEKVFSCNSA-N |
| XLogP | 0.22 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |