C12H20BrNS2 — CID 105134525
1-(5-bromothiophen-2-yl)-4-methylsulfanyl-N-propylbutan-2-amine (PubChem CID 105134525) has the molecular formula C12H20BrNS2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-4-methylsulfanyl-N-propylbutan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-4-methylsulfanyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 105134525 |
| Molecular Formula | C12H20BrNS2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-4-methylsulfanyl-N-propylbutan-2-amine |
| SMILES | CCCNC(CCSC)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C12H20BrNS2/c1-3-7-14-10(6-8-15-2)9-11-4-5-12(13)16-11/h4-5,10,14H,3,6-9H2,1-2H3 |
| InChIKey | SRSCLLLSMPHAMK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |