About 6-bromo-1H-indole-4,7-diol
6-bromo-1H-indole-4,7-diol (PubChem CID 10513513) has the molecular formula C8H6BrNO2
and a molecular weight of 228.04 g/mol. Its IUPAC name is 6-bromo-1H-indole-4,7-diol.
Molecular Properties
| Compound Name | 6-bromo-1H-indole-4,7-diol |
| PubChem CID | 10513513 |
| Molecular Formula | C8H6BrNO2 |
| Molecular Weight | 228.04 g/mol |
| Exact Mass | 226.96 |
| IUPAC Name | 6-bromo-1H-indole-4,7-diol |
| SMILES | Oc1cc(Br)c(O)c2[nH]ccc12 |
| InChI | InChI=1S/C8H6BrNO2/c9-5-3-6(11)4-1-2-10-7(4)8(5)12/h1-3,10-12H |
| InChIKey | QLTYFQFIBAIEHN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.04 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1H-indole-4,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-indole-4,7-diol?
The IUPAC name of 6-bromo-1H-indole-4,7-diol (CID 10513513) is 6-bromo-1H-indole-4,7-diol.
What is the SMILES notation for 6-bromo-1H-indole-4,7-diol?
The canonical SMILES for 6-bromo-1H-indole-4,7-diol is Oc1cc(Br)c(O)c2[nH]ccc12.
What is the InChIKey of 6-bromo-1H-indole-4,7-diol?
The InChIKey is QLTYFQFIBAIEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrNO2/c9-5-3-6(11)4-1-2-10-7(4)8(5)12/h1-3,10-12H.
What are the key properties of 6-bromo-1H-indole-4,7-diol?
6-bromo-1H-indole-4,7-diol has a molecular weight of 228.04 g/mol, XLogP of 2.34, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-indole-4,7-diol is sourced from PubChem (CID 10513513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).