C12H12F2OS — CID 105135754
2-(2,6-difluorophenyl)-1-(thiolan-3-yl)ethanone (PubChem CID 105135754) has the molecular formula C12H12F2OS and a molecular weight of 242.29 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-(thiolan-3-yl)ethanone.
| Compound Name | 2-(2,6-difluorophenyl)-1-(thiolan-3-yl)ethanone |
|---|---|
| PubChem CID | 105135754 |
| Molecular Formula | C12H12F2OS |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-(thiolan-3-yl)ethanone |
| SMILES | O=C(Cc1c(F)cccc1F)C1CCSC1 |
| InChI | InChI=1S/C12H12F2OS/c13-10-2-1-3-11(14)9(10)6-12(15)8-4-5-16-7-8/h1-3,8H,4-7H2 |
| InChIKey | DTRBBSJCRXKPRA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |