About 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene
1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene (PubChem CID 10513646) has the molecular formula C11H12F2OS
and a molecular weight of 230.28 g/mol. Its IUPAC name is 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene |
| PubChem CID | 10513646 |
| Molecular Formula | C11H12F2OS |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene |
| SMILES | Cc1ccc([S@](=O)/C=C/C(C)(F)F)cc1 |
| InChI | InChI=1S/C11H12F2OS/c1-9-3-5-10(6-4-9)15(14)8-7-11(2,12)13/h3-8H,1-2H3/b8-7+/t15-/m1/s1 |
| InChIKey | GQYJFKUUMKPHBO-MVGZEHJDSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene?
The IUPAC name of 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene (CID 10513646) is 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene.
What is the SMILES notation for 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene?
The canonical SMILES for 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene is Cc1ccc([S@](=O)/C=C/C(C)(F)F)cc1.
What is the InChIKey of 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene?
The InChIKey is GQYJFKUUMKPHBO-MVGZEHJDSA-N. The full InChI is InChI=1S/C11H12F2OS/c1-9-3-5-10(6-4-9)15(14)8-7-11(2,12)13/h3-8H,1-2H3/b8-7+/t15-/m1/s1.
What are the key properties of 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene?
1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene has a molecular weight of 230.28 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(R)-[(E)-3,3-difluorobut-1-enyl]sulfinyl]-4-methylbenzene is sourced from PubChem (CID 10513646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).