C15H17Cl2N3 — CID 105136520
N-[2-(3,4-dichlorophenyl)-1-pyridazin-4-ylethyl]propan-1-amine (PubChem CID 105136520) has the molecular formula C15H17Cl2N3 and a molecular weight of 310.23 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1-pyridazin-4-ylethyl]propan-1-amine.
| Compound Name | N-[2-(3,4-dichlorophenyl)-1-pyridazin-4-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 105136520 |
| Molecular Formula | C15H17Cl2N3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1-pyridazin-4-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Cl)c(Cl)c1)c1ccnnc1 |
| InChI | InChI=1S/C15H17Cl2N3/c1-2-6-18-15(12-5-7-19-20-10-12)9-11-3-4-13(16)14(17)8-11/h3-5,7-8,10,15,18H,2,6,9H2,1H3 |
| InChIKey | BSJGWTOLTVUJQM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |