C17H20Cl2N2 — CID 105136549
1-(3,4-dichlorophenyl)-N-ethyl-4-pyridin-2-ylbutan-2-amine (PubChem CID 105136549) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-ethyl-4-pyridin-2-ylbutan-2-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-ethyl-4-pyridin-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 105136549 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-ethyl-4-pyridin-2-ylbutan-2-amine |
| SMILES | CCNC(CCc1ccccn1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N2/c1-2-20-15(8-7-14-5-3-4-10-21-14)11-13-6-9-16(18)17(19)12-13/h3-6,9-10,12,15,20H,2,7-8,11H2,1H3 |
| InChIKey | CXSPDLGVBAALKN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |