C12H10BrF2NS — CID 105137743
1-(5-bromothiophen-3-yl)-2-(2,3-difluorophenyl)ethanamine (PubChem CID 105137743) has the molecular formula C12H10BrF2NS and a molecular weight of 318.19 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-2-(2,3-difluorophenyl)ethanamine.
| Compound Name | 1-(5-bromothiophen-3-yl)-2-(2,3-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 105137743 |
| Molecular Formula | C12H10BrF2NS |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-2-(2,3-difluorophenyl)ethanamine |
| SMILES | NC(Cc1cccc(F)c1F)c1csc(Br)c1 |
| InChI | InChI=1S/C12H10BrF2NS/c13-11-5-8(6-17-11)10(16)4-7-2-1-3-9(14)12(7)15/h1-3,5-6,10H,4,16H2 |
| InChIKey | YIGLFMRKUYWUSP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |