C17H32F3N — CID 105137916
3-methyl-N-propyl-1-[3-(trifluoromethyl)cyclohexyl]hexan-1-amine (PubChem CID 105137916) has the molecular formula C17H32F3N and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-methyl-N-propyl-1-[3-(trifluoromethyl)cyclohexyl]hexan-1-amine.
| Compound Name | 3-methyl-N-propyl-1-[3-(trifluoromethyl)cyclohexyl]hexan-1-amine |
|---|---|
| PubChem CID | 105137916 |
| Molecular Formula | C17H32F3N |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 3-methyl-N-propyl-1-[3-(trifluoromethyl)cyclohexyl]hexan-1-amine |
| SMILES | CCCNC(CC(C)CCC)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C17H32F3N/c1-4-7-13(3)11-16(21-10-5-2)14-8-6-9-15(12-14)17(18,19)20/h13-16,21H,4-12H2,1-3H3 |
| InChIKey | DHDMDDUQEDFROW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |