C12H19ClN2 — CID 105138462
1-(3-chloro-4-pyridinyl)-N,3-dimethylpentan-1-amine (PubChem CID 105138462) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-N,3-dimethylpentan-1-amine.
| Compound Name | 1-(3-chloro-4-pyridinyl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 105138462 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)CC(NC)c1ccncc1Cl |
| InChI | InChI=1S/C12H19ClN2/c1-4-9(2)7-12(14-3)10-5-6-15-8-11(10)13/h5-6,8-9,12,14H,4,7H2,1-3H3 |
| InChIKey | RKLHSVYWIVCVHU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |