C14H18O3 — CID 10513853
(1R,2S,6S,7R)-3-hydroxy-7-methoxy-9,9-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 10513853) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (1R,2S,6S,7R)-3-hydroxy-7-methoxy-9,9-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | (1R,2S,6S,7R)-3-hydroxy-7-methoxy-9,9-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 10513853 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1R,2S,6S,7R)-3-hydroxy-7-methoxy-9,9-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | CO[C@]12C=C[C@H]([C@@H]3C(O)C=C[C@@H]31)C(C)(C)C2=O |
| InChI | InChI=1S/C14H18O3/c1-13(2)8-6-7-14(17-3,12(13)16)9-4-5-10(15)11(8)9/h4-11,15H,1-3H3/t8-,9+,10?,11+,14-/m1/s1 |
| InChIKey | SRPRUEGMTUJXKT-GOALFRKDSA-N |
| XLogP | 1.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|