C19H25NO — CID 105138718
N-methyl-1-naphthalen-2-yl-3-(oxan-4-yl)propan-2-amine (PubChem CID 105138718) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is N-methyl-1-naphthalen-2-yl-3-(oxan-4-yl)propan-2-amine.
| Compound Name | N-methyl-1-naphthalen-2-yl-3-(oxan-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 105138718 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N-methyl-1-naphthalen-2-yl-3-(oxan-4-yl)propan-2-amine |
| SMILES | CNC(Cc1ccc2ccccc2c1)CC1CCOCC1 |
| InChI | InChI=1S/C19H25NO/c1-20-19(13-15-8-10-21-11-9-15)14-16-6-7-17-4-2-3-5-18(17)12-16/h2-7,12,15,19-20H,8-11,13-14H2,1H3 |
| InChIKey | XTRGDIIKVQHJMH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |