About 2-methyl-2,5-diphenyl-3,4-dihydropyrrole
2-methyl-2,5-diphenyl-3,4-dihydropyrrole (PubChem CID 10513929) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-methyl-2,5-diphenyl-3,4-dihydropyrrole.
Molecular Properties
| Compound Name | 2-methyl-2,5-diphenyl-3,4-dihydropyrrole |
| PubChem CID | 10513929 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-methyl-2,5-diphenyl-3,4-dihydropyrrole |
| SMILES | CC1(c2ccccc2)CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C17H17N/c1-17(15-10-6-3-7-11-15)13-12-16(18-17)14-8-4-2-5-9-14/h2-11H,12-13H2,1H3 |
| InChIKey | KIIBWPGMEWXRAI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-2,5-diphenyl-3,4-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,5-diphenyl-3,4-dihydropyrrole?
The IUPAC name of 2-methyl-2,5-diphenyl-3,4-dihydropyrrole (CID 10513929) is 2-methyl-2,5-diphenyl-3,4-dihydropyrrole.
What is the SMILES notation for 2-methyl-2,5-diphenyl-3,4-dihydropyrrole?
The canonical SMILES for 2-methyl-2,5-diphenyl-3,4-dihydropyrrole is CC1(c2ccccc2)CCC(c2ccccc2)=N1.
What is the InChIKey of 2-methyl-2,5-diphenyl-3,4-dihydropyrrole?
The InChIKey is KIIBWPGMEWXRAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N/c1-17(15-10-6-3-7-11-15)13-12-16(18-17)14-8-4-2-5-9-14/h2-11H,12-13H2,1H3.
What are the key properties of 2-methyl-2,5-diphenyl-3,4-dihydropyrrole?
2-methyl-2,5-diphenyl-3,4-dihydropyrrole has a molecular weight of 235.33 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,5-diphenyl-3,4-dihydropyrrole is sourced from PubChem (CID 10513929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).