About 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one
6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one (PubChem CID 10513945) has the molecular formula C7H7Cl2N3O2
and a molecular weight of 236.06 g/mol. Its IUPAC name is 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one |
| PubChem CID | 10513945 |
| Molecular Formula | C7H7Cl2N3O2 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one |
| SMILES | CC(=O)Cn1nc(N)c(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C7H7Cl2N3O2/c1-3(13)2-12-7(14)5(9)4(8)6(10)11-12/h2H2,1H3,(H2,10,11) |
| InChIKey | HTCZVUOLRVWHEH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one?
The IUPAC name of 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one (CID 10513945) is 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one.
What is the SMILES notation for 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one?
The canonical SMILES for 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one is CC(=O)Cn1nc(N)c(Cl)c(Cl)c1=O.
What is the InChIKey of 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one?
The InChIKey is HTCZVUOLRVWHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl2N3O2/c1-3(13)2-12-7(14)5(9)4(8)6(10)11-12/h2H2,1H3,(H2,10,11).
What are the key properties of 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one?
6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one has a molecular weight of 236.06 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one is sourced from PubChem (CID 10513945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).