C15H24O2 — CID 10514001
ethyl (2Z,6R,8E,10E)-6-methyldodeca-2,8,10-trienoate (PubChem CID 10514001) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is ethyl (2Z,6R,8E,10E)-6-methyldodeca-2,8,10-trienoate.
| Compound Name | ethyl (2Z,6R,8E,10E)-6-methyldodeca-2,8,10-trienoate |
|---|---|
| PubChem CID | 10514001 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | ethyl (2Z,6R,8E,10E)-6-methyldodeca-2,8,10-trienoate |
| SMILES | C/C=C/C=C/C[C@H](C)CC/C=C\C(=O)OCC |
| InChI | InChI=1S/C15H24O2/c1-4-6-7-8-11-14(3)12-9-10-13-15(16)17-5-2/h4,6-8,10,13-14H,5,9,11-12H2,1-3H3/b6-4+,8-7+,13-10-/t14-/m0/s1 |
| InChIKey | RWVYWNGZDHCVPV-UCSCGATDSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|