C12H14O5 — CID 10514060
methyl (3aS,3bR,6aR,7aS)-1,5-dioxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate (PubChem CID 10514060) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is methyl (3aS,3bR,6aR,7aS)-1,5-dioxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate.
| Compound Name | methyl (3aS,3bR,6aR,7aS)-1,5-dioxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate |
|---|---|
| PubChem CID | 10514060 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methyl (3aS,3bR,6aR,7aS)-1,5-dioxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate |
| SMILES | COC(=O)[C@]12CC(=O)C[C@H]1C[C@@H]1C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C12H14O5/c1-16-11(15)12-4-7(13)2-6(12)3-8-9(12)5-17-10(8)14/h6,8-9H,2-5H2,1H3/t6-,8-,9-,12+/m0/s1 |
| InChIKey | WQNNFRUNAGBWLS-HAVGOBCSSA-N |
| XLogP | 0.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |