C11H16ClNOS — CID 105141041
1-(5-chloro-2-methoxyphenyl)-3-methylsulfanylpropan-1-amine (PubChem CID 105141041) has the molecular formula C11H16ClNOS and a molecular weight of 245.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-methylsulfanylpropan-1-amine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 105141041 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-methylsulfanylpropan-1-amine |
| SMILES | COc1ccc(Cl)cc1C(N)CCSC |
| InChI | InChI=1S/C11H16ClNOS/c1-14-11-4-3-8(12)7-9(11)10(13)5-6-15-2/h3-4,7,10H,5-6,13H2,1-2H3 |
| InChIKey | ASQSNUVYVULXLG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |