C14H14F3N3O — CID 105141520
N-[pyridazin-4-yl-[2-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 105141520) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is N-[pyridazin-4-yl-[2-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[pyridazin-4-yl-[2-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 105141520 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[pyridazin-4-yl-[2-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | CCNC(c1ccnnc1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O/c1-2-18-13(10-7-8-19-20-9-10)11-5-3-4-6-12(11)21-14(15,16)17/h3-9,13,18H,2H2,1H3 |
| InChIKey | CLFXRYYXAJBUIL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |