C13H14F3N3S — CID 105142581
N-[thiadiazol-4-yl-[4-(trifluoromethyl)phenyl]methyl]propan-1-amine (PubChem CID 105142581) has the molecular formula C13H14F3N3S and a molecular weight of 301.34 g/mol. Its IUPAC name is N-[thiadiazol-4-yl-[4-(trifluoromethyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[thiadiazol-4-yl-[4-(trifluoromethyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 105142581 |
| Molecular Formula | C13H14F3N3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[thiadiazol-4-yl-[4-(trifluoromethyl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(C(F)(F)F)cc1)c1csnn1 |
| InChI | InChI=1S/C13H14F3N3S/c1-2-7-17-12(11-8-20-19-18-11)9-3-5-10(6-4-9)13(14,15)16/h3-6,8,12,17H,2,7H2,1H3 |
| InChIKey | OPUVPKMVDWAOJZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |