About 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol
1-cyclohexyl-2,2-diethoxybut-3-en-1-ol (PubChem CID 10514323) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol |
| PubChem CID | 10514323 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol |
| SMILES | C=CC(OCC)(OCC)C(O)C1CCCCC1 |
| InChI | InChI=1S/C14H26O3/c1-4-14(16-5-2,17-6-3)13(15)12-10-8-7-9-11-12/h4,12-13,15H,1,5-11H2,2-3H3 |
| InChIKey | BZMZMHPEIYETAU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol?
The IUPAC name of 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol (CID 10514323) is 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol.
What is the SMILES notation for 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol?
The canonical SMILES for 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol is C=CC(OCC)(OCC)C(O)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol?
The InChIKey is BZMZMHPEIYETAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-4-14(16-5-2,17-6-3)13(15)12-10-8-7-9-11-12/h4,12-13,15H,1,5-11H2,2-3H3.
What are the key properties of 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol?
1-cyclohexyl-2,2-diethoxybut-3-en-1-ol has a molecular weight of 242.36 g/mol, XLogP of 2.88, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,2-diethoxybut-3-en-1-ol is sourced from PubChem (CID 10514323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).