C12H15F2NS — CID 105143702
1-(2,4-difluorophenyl)-N-methyl-1-(thiolan-3-yl)methanamine (PubChem CID 105143702) has the molecular formula C12H15F2NS and a molecular weight of 243.32 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-methyl-1-(thiolan-3-yl)methanamine.
| Compound Name | 1-(2,4-difluorophenyl)-N-methyl-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 105143702 |
| Molecular Formula | C12H15F2NS |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-methyl-1-(thiolan-3-yl)methanamine |
| SMILES | CNC(c1ccc(F)cc1F)C1CCSC1 |
| InChI | InChI=1S/C12H15F2NS/c1-15-12(8-4-5-16-7-8)10-3-2-9(13)6-11(10)14/h2-3,6,8,12,15H,4-5,7H2,1H3 |
| InChIKey | WEGUGBSDTLZMGD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |