C16H13F2N3 — CID 105143729
1-(2,4-difluorophenyl)-N-methyl-1-quinoxalin-5-ylmethanamine (PubChem CID 105143729) has the molecular formula C16H13F2N3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-methyl-1-quinoxalin-5-ylmethanamine.
| Compound Name | 1-(2,4-difluorophenyl)-N-methyl-1-quinoxalin-5-ylmethanamine |
|---|---|
| PubChem CID | 105143729 |
| Molecular Formula | C16H13F2N3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-methyl-1-quinoxalin-5-ylmethanamine |
| SMILES | CNC(c1ccc(F)cc1F)c1cccc2nccnc12 |
| InChI | InChI=1S/C16H13F2N3/c1-19-15(11-6-5-10(17)9-13(11)18)12-3-2-4-14-16(12)21-8-7-20-14/h2-9,15,19H,1H3 |
| InChIKey | KSZRODQOVNBIFI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |