C10H15NO6 — CID 10514488
(3S,5S)-3-methyl-5-[4-(1,2,4-trioxolan-3-yl)butyl]-1,2,4-trioxolane-3-carbonitrile (PubChem CID 10514488) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is (3S,5S)-3-methyl-5-[4-(1,2,4-trioxolan-3-yl)butyl]-1,2,4-trioxolane-3-carbonitrile.
| Compound Name | (3S,5S)-3-methyl-5-[4-(1,2,4-trioxolan-3-yl)butyl]-1,2,4-trioxolane-3-carbonitrile |
|---|---|
| PubChem CID | 10514488 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (3S,5S)-3-methyl-5-[4-(1,2,4-trioxolan-3-yl)butyl]-1,2,4-trioxolane-3-carbonitrile |
| SMILES | C[C@@]1(C#N)OO[C@@H](CCCCC2OCOO2)O1 |
| InChI | InChI=1S/C10H15NO6/c1-10(6-11)14-9(16-17-10)5-3-2-4-8-12-7-13-15-8/h8-9H,2-5,7H2,1H3/t8?,9-,10-/m0/s1 |
| InChIKey | AIGPIMUCQZFRPR-AGROOBSYSA-N |
| XLogP | 1.35 |
| TPSA | 79.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|