C13H20ClNO — CID 105146009
4-(3-chlorophenoxy)-2,2-dimethylpentan-3-amine (PubChem CID 105146009) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 4-(3-chlorophenoxy)-2,2-dimethylpentan-3-amine.
| Compound Name | 4-(3-chlorophenoxy)-2,2-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 105146009 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-(3-chlorophenoxy)-2,2-dimethylpentan-3-amine |
| SMILES | CC(Oc1cccc(Cl)c1)C(N)C(C)(C)C |
| InChI | InChI=1S/C13H20ClNO/c1-9(12(15)13(2,3)4)16-11-7-5-6-10(14)8-11/h5-9,12H,15H2,1-4H3 |
| InChIKey | HQVRPWXUJSKELP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |