C15H12F3NS — CID 105146408
2,3-dihydro-1-benzothiophen-2-yl-(2,3,4-trifluorophenyl)methanamine (PubChem CID 105146408) has the molecular formula C15H12F3NS and a molecular weight of 295.33 g/mol. Its IUPAC name is 2,3-dihydro-1-benzothiophen-2-yl-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | 2,3-dihydro-1-benzothiophen-2-yl-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 105146408 |
| Molecular Formula | C15H12F3NS |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2,3-dihydro-1-benzothiophen-2-yl-(2,3,4-trifluorophenyl)methanamine |
| SMILES | NC(c1ccc(F)c(F)c1F)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H12F3NS/c16-10-6-5-9(13(17)14(10)18)15(19)12-7-8-3-1-2-4-11(8)20-12/h1-6,12,15H,7,19H2 |
| InChIKey | HTXMKMSLSNWZAT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|