C15H15F3N2O — CID 105146502
N-[(2-methoxy-3-pyridinyl)-(2,3,4-trifluorophenyl)methyl]ethanamine (PubChem CID 105146502) has the molecular formula C15H15F3N2O and a molecular weight of 296.29 g/mol. Its IUPAC name is N-[(2-methoxy-3-pyridinyl)-(2,3,4-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[(2-methoxy-3-pyridinyl)-(2,3,4-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105146502 |
| Molecular Formula | C15H15F3N2O |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-[(2-methoxy-3-pyridinyl)-(2,3,4-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cccnc1OC)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H15F3N2O/c1-3-19-14(10-5-4-8-20-15(10)21-2)9-6-7-11(16)13(18)12(9)17/h4-8,14,19H,3H2,1-2H3 |
| InChIKey | KKAQGOCSJWEZKU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|