C17H16N2 — CID 10514716
3-methyl-3,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1,4,6,11,13,15,17-heptaene (PubChem CID 10514716) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-methyl-3,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1,4,6,11,13,15,17-heptaene.
| Compound Name | 3-methyl-3,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1,4,6,11,13,15,17-heptaene |
|---|---|
| PubChem CID | 10514716 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-methyl-3,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1,4,6,11,13,15,17-heptaene |
| SMILES | CN1C=CC=C2CCCC3=c4ccccc4=NC3=C21 |
| InChI | InChI=1S/C17H16N2/c1-19-11-5-7-12-6-4-9-14-13-8-2-3-10-15(13)18-16(14)17(12)19/h2-3,5,7-8,10-11H,4,6,9H2,1H3 |
| InChIKey | MAROWNVYSFZFNL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |