C14H23NO2 — CID 105147712
3-(furan-2-yl)-1-(oxolan-3-yl)-N-propylpropan-1-amine (PubChem CID 105147712) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-(oxolan-3-yl)-N-propylpropan-1-amine.
| Compound Name | 3-(furan-2-yl)-1-(oxolan-3-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 105147712 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 3-(furan-2-yl)-1-(oxolan-3-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CCc1ccco1)C1CCOC1 |
| InChI | InChI=1S/C14H23NO2/c1-2-8-15-14(12-7-10-16-11-12)6-5-13-4-3-9-17-13/h3-4,9,12,14-15H,2,5-8,10-11H2,1H3 |
| InChIKey | LMAGRFNPZVWFOH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |